C17H15F3O3 — CID 132514950
methyl 4-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]benzoate (PubChem CID 132514950) has the molecular formula C17H15F3O3 and a molecular weight of 324.30 g/mol. Its IUPAC name is methyl 4-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]benzoate.
| Compound Name | methyl 4-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]benzoate |
|---|---|
| PubChem CID | 132514950 |
| Molecular Formula | C17H15F3O3 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | methyl 4-[2,2,2-trifluoro-1-(4-methoxyphenyl)ethyl]benzoate |
| SMILES | COC(=O)c1ccc(C(c2ccc(OC)cc2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H15F3O3/c1-22-14-9-7-12(8-10-14)15(17(18,19)20)11-3-5-13(6-4-11)16(21)23-2/h3-10,15H,1-2H3 |
| InChIKey | KOOGMJRLWMEUAW-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |