C18H20O5 — CID 177460702
methyl 4-[1,2-dihydroxy-1-(4-methoxyphenyl)propan-2-yl]benzoate (PubChem CID 177460702) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is methyl 4-[1,2-dihydroxy-1-(4-methoxyphenyl)propan-2-yl]benzoate.
| Compound Name | methyl 4-[1,2-dihydroxy-1-(4-methoxyphenyl)propan-2-yl]benzoate |
|---|---|
| PubChem CID | 177460702 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | methyl 4-[1,2-dihydroxy-1-(4-methoxyphenyl)propan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(C(C)(O)C(O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C18H20O5/c1-18(21,14-8-4-13(5-9-14)17(20)23-3)16(19)12-6-10-15(22-2)11-7-12/h4-11,16,19,21H,1-3H3 |
| InChIKey | GEMSKTMVDRJMTQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |