C12H12F2O3 — CID 125474515
methyl 4-[(1R)-2,2-difluoro-1-hydroxybut-3-enyl]benzoate (PubChem CID 125474515) has the molecular formula C12H12F2O3 and a molecular weight of 242.22 g/mol. Its IUPAC name is methyl 4-[(1R)-2,2-difluoro-1-hydroxybut-3-enyl]benzoate.
| Compound Name | methyl 4-[(1R)-2,2-difluoro-1-hydroxybut-3-enyl]benzoate |
|---|---|
| PubChem CID | 125474515 |
| Molecular Formula | C12H12F2O3 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | methyl 4-[(1R)-2,2-difluoro-1-hydroxybut-3-enyl]benzoate |
| SMILES | C=CC(F)(F)[C@H](O)c1ccc(C(=O)OC)cc1 |
| InChI | InChI=1S/C12H12F2O3/c1-3-12(13,14)10(15)8-4-6-9(7-5-8)11(16)17-2/h3-7,10,15H,1H2,2H3/t10-/m1/s1 |
| InChIKey | LTBGJKZTVDQCGL-SNVBAGLBSA-N |
| XLogP | 2.33 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|