About methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate
methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate (PubChem CID 160898389) has the molecular formula C24H20F3IO4
and a molecular weight of 556.32 g/mol. Its IUPAC name is methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate |
| PubChem CID | 160898389 |
| Molecular Formula | C24H20F3IO4 |
| Molecular Weight | 556.32 g/mol |
| Exact Mass | 556.04 |
| IUPAC Name | methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate |
| SMILES | COC(=O)c1ccc(-c2cc(C)cc(C(F)(F)F)c2)cc1.COC(=O)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H13F3O2.C8H7IO2/c1-10-7-13(9-14(8-10)16(17,18)19)11-3-5-12(6-4-11)15(20)21-2;1-11-8(10)6-2-4-7(9)5-3-6/h3-9H,1-2H3;2-5H,1H3 |
| InChIKey | SPEHJQCDBHAOIE-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 556.32 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate?
The IUPAC name of methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate (CID 160898389) is methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate.
What is the SMILES notation for methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate?
The canonical SMILES for methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate is COC(=O)c1ccc(-c2cc(C)cc(C(F)(F)F)c2)cc1.COC(=O)c1ccc(I)cc1.
What is the InChIKey of methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate?
The InChIKey is SPEHJQCDBHAOIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13F3O2.C8H7IO2/c1-10-7-13(9-14(8-10)16(17,18)19)11-3-5-12(6-4-11)15(20)21-2;1-11-8(10)6-2-4-7(9)5-3-6/h3-9H,1-2H3;2-5H,1H3.
What are the key properties of methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate?
methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate has a molecular weight of 556.32 g/mol, XLogP of 6.55, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-iodobenzoate;methyl 4-[3-methyl-5-(trifluoromethyl)phenyl]benzoate is sourced from PubChem (CID 160898389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).