C20H22F2O2 — CID 102301048
methyl 3-(4-tert-butylphenyl)-5-(1,1-difluoroethyl)benzoate (PubChem CID 102301048) has the molecular formula C20H22F2O2 and a molecular weight of 332.39 g/mol. Its IUPAC name is methyl 3-(4-tert-butylphenyl)-5-(1,1-difluoroethyl)benzoate.
| Compound Name | methyl 3-(4-tert-butylphenyl)-5-(1,1-difluoroethyl)benzoate |
|---|---|
| PubChem CID | 102301048 |
| Molecular Formula | C20H22F2O2 |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | methyl 3-(4-tert-butylphenyl)-5-(1,1-difluoroethyl)benzoate |
| SMILES | COC(=O)c1cc(-c2ccc(C(C)(C)C)cc2)cc(C(C)(F)F)c1 |
| InChI | InChI=1S/C20H22F2O2/c1-19(2,3)16-8-6-13(7-9-16)14-10-15(18(23)24-5)12-17(11-14)20(4,21)22/h6-12H,1-5H3 |
| InChIKey | VDVQFDUGOAOKIP-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |