C20H23NO4 — CID 155291762
dimethyl 5-(4-tert-butylanilino)benzene-1,3-dicarboxylate (PubChem CID 155291762) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is dimethyl 5-(4-tert-butylanilino)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(4-tert-butylanilino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 155291762 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | dimethyl 5-(4-tert-butylanilino)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2ccc(C(C)(C)C)cc2)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H23NO4/c1-20(2,3)15-6-8-16(9-7-15)21-17-11-13(18(22)24-4)10-14(12-17)19(23)25-5/h6-12,21H,1-5H3 |
| InChIKey | UNLVMBGQQXQWPD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |