C18H19NO4 — CID 155291494
dimethyl 5-(2,6-dimethylanilino)benzene-1,3-dicarboxylate (PubChem CID 155291494) has the molecular formula C18H19NO4 and a molecular weight of 313.35 g/mol. Its IUPAC name is dimethyl 5-(2,6-dimethylanilino)benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-(2,6-dimethylanilino)benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 155291494 |
| Molecular Formula | C18H19NO4 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | dimethyl 5-(2,6-dimethylanilino)benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(Nc2c(C)cccc2C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C18H19NO4/c1-11-6-5-7-12(2)16(11)19-15-9-13(17(20)22-3)8-14(10-15)18(21)23-4/h5-10,19H,1-4H3 |
| InChIKey | FEDDIUBUNIJFCT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |