C18H17NO8S — CID 43069576
2-[[3,5-bis(methoxycarbonyl)phenyl]sulfonylamino]-3-methylbenzoic acid (PubChem CID 43069576) has the molecular formula C18H17NO8S and a molecular weight of 407.40 g/mol. Its IUPAC name is 2-[[3,5-bis(methoxycarbonyl)phenyl]sulfonylamino]-3-methylbenzoic acid.
| Compound Name | 2-[[3,5-bis(methoxycarbonyl)phenyl]sulfonylamino]-3-methylbenzoic acid |
|---|---|
| PubChem CID | 43069576 |
| Molecular Formula | C18H17NO8S |
| Molecular Weight | 407.40 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | 2-[[3,5-bis(methoxycarbonyl)phenyl]sulfonylamino]-3-methylbenzoic acid |
| SMILES | COC(=O)c1cc(C(=O)OC)cc(S(=O)(=O)Nc2c(C)cccc2C(=O)O)c1 |
| InChI | InChI=1S/C18H17NO8S/c1-10-5-4-6-14(16(20)21)15(10)19-28(24,25)13-8-11(17(22)26-2)7-12(9-13)18(23)27-3/h4-9,19H,1-3H3,(H,20,21) |
| InChIKey | YNAGADXTCBEDOW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 136.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.40 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |