C18H19NO9S — CID 31703151
3,4,5-trimethoxy-2-[(3-methoxycarbonylphenyl)sulfonylamino]benzoic acid (PubChem CID 31703151) has the molecular formula C18H19NO9S and a molecular weight of 425.42 g/mol. Its IUPAC name is 3,4,5-trimethoxy-2-[(3-methoxycarbonylphenyl)sulfonylamino]benzoic acid.
| Compound Name | 3,4,5-trimethoxy-2-[(3-methoxycarbonylphenyl)sulfonylamino]benzoic acid |
|---|---|
| PubChem CID | 31703151 |
| Molecular Formula | C18H19NO9S |
| Molecular Weight | 425.42 g/mol |
| Exact Mass | 425.08 |
| IUPAC Name | 3,4,5-trimethoxy-2-[(3-methoxycarbonylphenyl)sulfonylamino]benzoic acid |
| SMILES | COC(=O)c1cccc(S(=O)(=O)Nc2c(C(=O)O)cc(OC)c(OC)c2OC)c1 |
| InChI | InChI=1S/C18H19NO9S/c1-25-13-9-12(17(20)21)14(16(27-3)15(13)26-2)19-29(23,24)11-7-5-6-10(8-11)18(22)28-4/h5-9,19H,1-4H3,(H,20,21) |
| InChIKey | WKHUOYXKZFJVQC-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 137.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |