C17H18N2O8S — CID 45307853
2-[(4-carbamoylphenyl)sulfonylamino]-3,4,5-trimethoxybenzoic acid (PubChem CID 45307853) has the molecular formula C17H18N2O8S and a molecular weight of 410.40 g/mol. Its IUPAC name is 2-[(4-carbamoylphenyl)sulfonylamino]-3,4,5-trimethoxybenzoic acid.
| Compound Name | 2-[(4-carbamoylphenyl)sulfonylamino]-3,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 45307853 |
| Molecular Formula | C17H18N2O8S |
| Molecular Weight | 410.40 g/mol |
| Exact Mass | 410.08 |
| IUPAC Name | 2-[(4-carbamoylphenyl)sulfonylamino]-3,4,5-trimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(NS(=O)(=O)c2ccc(C(N)=O)cc2)c(OC)c1OC |
| InChI | InChI=1S/C17H18N2O8S/c1-25-12-8-11(17(21)22)13(15(27-3)14(12)26-2)19-28(23,24)10-6-4-9(5-7-10)16(18)20/h4-8,19H,1-3H3,(H2,18,20)(H,21,22) |
| InChIKey | NEMQTQRTERQOJB-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 154.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.40 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |