C11H14N2O5S — CID 169356258
2-(carbamothioylamino)-3,4,5-trimethoxybenzoic acid (PubChem CID 169356258) has the molecular formula C11H14N2O5S and a molecular weight of 286.31 g/mol. Its IUPAC name is 2-(carbamothioylamino)-3,4,5-trimethoxybenzoic acid.
| Compound Name | 2-(carbamothioylamino)-3,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 169356258 |
| Molecular Formula | C11H14N2O5S |
| Molecular Weight | 286.31 g/mol |
| Exact Mass | 286.06 |
| IUPAC Name | 2-(carbamothioylamino)-3,4,5-trimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(NC(N)=S)c(OC)c1OC |
| InChI | InChI=1S/C11H14N2O5S/c1-16-6-4-5(10(14)15)7(13-11(12)19)9(18-3)8(6)17-2/h4H,1-3H3,(H,14,15)(H3,12,13,19) |
| InChIKey | PQPLZDFHXATQFH-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.31 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|