C12H15ClN2O5 — CID 169365503
2-[(1-amino-2-chloroethylidene)amino]-3,4,5-trimethoxybenzoic acid (PubChem CID 169365503) has the molecular formula C12H15ClN2O5 and a molecular weight of 302.71 g/mol. Its IUPAC name is 2-[(1-amino-2-chloroethylidene)amino]-3,4,5-trimethoxybenzoic acid.
| Compound Name | 2-[(1-amino-2-chloroethylidene)amino]-3,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 169365503 |
| Molecular Formula | C12H15ClN2O5 |
| Molecular Weight | 302.71 g/mol |
| Exact Mass | 302.07 |
| IUPAC Name | 2-[(1-amino-2-chloroethylidene)amino]-3,4,5-trimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(/N=C(/N)CCl)c(OC)c1OC |
| InChI | InChI=1S/C12H15ClN2O5/c1-18-7-4-6(12(16)17)9(15-8(14)5-13)11(20-3)10(7)19-2/h4H,5H2,1-3H3,(H2,14,15)(H,16,17) |
| InChIKey | HBPMUVAMUAFBOA-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 103.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.71 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|