C16H15FN2O5 — CID 118132185
2-[(4-fluorophenyl)diazenyl]-3,4,5-trimethoxybenzoic acid (PubChem CID 118132185) has the molecular formula C16H15FN2O5 and a molecular weight of 334.30 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)diazenyl]-3,4,5-trimethoxybenzoic acid.
| Compound Name | 2-[(4-fluorophenyl)diazenyl]-3,4,5-trimethoxybenzoic acid |
|---|---|
| PubChem CID | 118132185 |
| Molecular Formula | C16H15FN2O5 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 2-[(4-fluorophenyl)diazenyl]-3,4,5-trimethoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)c(/N=N/c2ccc(F)cc2)c(OC)c1OC |
| InChI | InChI=1S/C16H15FN2O5/c1-22-12-8-11(16(20)21)13(15(24-3)14(12)23-2)19-18-10-6-4-9(17)5-7-10/h4-8H,1-3H3,(H,20,21)/b19-18+ |
| InChIKey | CYEULBKFVGRGCM-VHEBQXMUSA-N |
| XLogP | 3.97 |
| TPSA | 89.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|