C13H17ClN2O5 — CID 169368257
methyl 2-[(1-amino-2-chloroethylidene)amino]-3,4,5-trimethoxybenzoate (PubChem CID 169368257) has the molecular formula C13H17ClN2O5 and a molecular weight of 316.74 g/mol. Its IUPAC name is methyl 2-[(1-amino-2-chloroethylidene)amino]-3,4,5-trimethoxybenzoate.
| Compound Name | methyl 2-[(1-amino-2-chloroethylidene)amino]-3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 169368257 |
| Molecular Formula | C13H17ClN2O5 |
| Molecular Weight | 316.74 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | methyl 2-[(1-amino-2-chloroethylidene)amino]-3,4,5-trimethoxybenzoate |
| SMILES | COC(=O)c1cc(OC)c(OC)c(OC)c1/N=C(/N)CCl |
| InChI | InChI=1S/C13H17ClN2O5/c1-18-8-5-7(13(17)21-4)10(16-9(15)6-14)12(20-3)11(8)19-2/h5H,6H2,1-4H3,(H2,15,16) |
| InChIKey | PUWJNEZYRMQMTH-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 92.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.74 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|