C15H22ClN3O3 — CID 169367971
3-[(1-amino-2-chloroethylidene)amino]-N,N-diethyl-4,5-dimethoxybenzamide (PubChem CID 169367971) has the molecular formula C15H22ClN3O3 and a molecular weight of 327.81 g/mol. Its IUPAC name is 3-[(1-amino-2-chloroethylidene)amino]-N,N-diethyl-4,5-dimethoxybenzamide.
| Compound Name | 3-[(1-amino-2-chloroethylidene)amino]-N,N-diethyl-4,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 169367971 |
| Molecular Formula | C15H22ClN3O3 |
| Molecular Weight | 327.81 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 3-[(1-amino-2-chloroethylidene)amino]-N,N-diethyl-4,5-dimethoxybenzamide |
| SMILES | CCN(CC)C(=O)c1cc(/N=C(/N)CCl)c(OC)c(OC)c1 |
| InChI | InChI=1S/C15H22ClN3O3/c1-5-19(6-2)15(20)10-7-11(18-13(17)9-16)14(22-4)12(8-10)21-3/h7-8H,5-6,9H2,1-4H3,(H2,17,18) |
| InChIKey | GKTUXMUPBHZOAT-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 77.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.81 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|