C10H12Cl2N2O2 — CID 169369656
2-chloro-N'-(4-chloro-2,5-dimethoxyphenyl)ethanimidamide (PubChem CID 169369656) has the molecular formula C10H12Cl2N2O2 and a molecular weight of 263.12 g/mol. Its IUPAC name is 2-chloro-N'-(4-chloro-2,5-dimethoxyphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(4-chloro-2,5-dimethoxyphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169369656 |
| Molecular Formula | C10H12Cl2N2O2 |
| Molecular Weight | 263.12 g/mol |
| Exact Mass | 262.03 |
| IUPAC Name | 2-chloro-N'-(4-chloro-2,5-dimethoxyphenyl)ethanimidamide |
| SMILES | COc1cc(/N=C(/N)CCl)c(OC)cc1Cl |
| InChI | InChI=1S/C10H12Cl2N2O2/c1-15-8-4-7(14-10(13)5-11)9(16-2)3-6(8)12/h3-4H,5H2,1-2H3,(H2,13,14) |
| InChIKey | BGIMFIZWQSWVMB-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.12 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|