C14H20ClN3O3 — CID 169367962
2-chloro-N'-(2,5-dimethoxy-4-morpholin-4-ylphenyl)ethanimidamide (PubChem CID 169367962) has the molecular formula C14H20ClN3O3 and a molecular weight of 313.79 g/mol. Its IUPAC name is 2-chloro-N'-(2,5-dimethoxy-4-morpholin-4-ylphenyl)ethanimidamide.
| Compound Name | 2-chloro-N'-(2,5-dimethoxy-4-morpholin-4-ylphenyl)ethanimidamide |
|---|---|
| PubChem CID | 169367962 |
| Molecular Formula | C14H20ClN3O3 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-chloro-N'-(2,5-dimethoxy-4-morpholin-4-ylphenyl)ethanimidamide |
| SMILES | COc1cc(N2CCOCC2)c(OC)cc1/N=C(/N)CCl |
| InChI | InChI=1S/C14H20ClN3O3/c1-19-12-8-11(18-3-5-21-6-4-18)13(20-2)7-10(12)17-14(16)9-15/h7-8H,3-6,9H2,1-2H3,(H2,16,17) |
| InChIKey | IOPXULPPPSMFMG-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 69.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|