C15H20N2O4 — CID 170877800
(E)-3-(2,5-dimethoxy-4-morpholin-4-ylphenyl)prop-2-enamide (PubChem CID 170877800) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is (E)-3-(2,5-dimethoxy-4-morpholin-4-ylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2,5-dimethoxy-4-morpholin-4-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 170877800 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | (E)-3-(2,5-dimethoxy-4-morpholin-4-ylphenyl)prop-2-enamide |
| SMILES | COc1cc(N2CCOCC2)c(OC)cc1/C=C/C(N)=O |
| InChI | InChI=1S/C15H20N2O4/c1-19-13-10-12(17-5-7-21-8-6-17)14(20-2)9-11(13)3-4-15(16)18/h3-4,9-10H,5-8H2,1-2H3,(H2,16,18)/b4-3+ |
| InChIKey | WFHSSMKMHGBXTQ-ONEGZZNKSA-N |
| XLogP | 1.04 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|