C16H22N2O2 — CID 170877788
(Z)-3-(4-morpholin-4-yl-3-propan-2-ylphenyl)prop-2-enamide (PubChem CID 170877788) has the molecular formula C16H22N2O2 and a molecular weight of 274.36 g/mol. Its IUPAC name is (Z)-3-(4-morpholin-4-yl-3-propan-2-ylphenyl)prop-2-enamide.
| Compound Name | (Z)-3-(4-morpholin-4-yl-3-propan-2-ylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 170877788 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | (Z)-3-(4-morpholin-4-yl-3-propan-2-ylphenyl)prop-2-enamide |
| SMILES | CC(C)c1cc(/C=C\C(N)=O)ccc1N1CCOCC1 |
| InChI | InChI=1S/C16H22N2O2/c1-12(2)14-11-13(4-6-16(17)19)3-5-15(14)18-7-9-20-10-8-18/h3-6,11-12H,7-10H2,1-2H3,(H2,17,19)/b6-4- |
| InChIKey | OXXJIFSUXONQCM-XQRVVYSFSA-N |
| XLogP | 2.15 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|