C13H13N2O5- — CID 7325851
(E)-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enoate (PubChem CID 7325851) has the molecular formula C13H13N2O5- and a molecular weight of 277.26 g/mol. Its IUPAC name is (E)-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enoate.
| Compound Name | (E)-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 7325851 |
| Molecular Formula | C13H13N2O5- |
| Molecular Weight | 277.26 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (E)-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enoate |
| SMILES | O=C([O-])/C=C/c1ccc(N2CCOCC2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H14N2O5/c16-13(17)4-2-10-1-3-11(12(9-10)15(18)19)14-5-7-20-8-6-14/h1-4,9H,5-8H2,(H,16,17)/p-1/b4-2+ |
| InChIKey | JPHPRPXBTGGJEW-DUXPYHPUSA-M |
| XLogP | 0.19 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.26 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|