C16H18N8O4S — CID 17334740
(E)-N-[(2-methyltetrazol-5-yl)carbamothioyl]-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enamide (PubChem CID 17334740) has the molecular formula C16H18N8O4S and a molecular weight of 418.44 g/mol. Its IUPAC name is (E)-N-[(2-methyltetrazol-5-yl)carbamothioyl]-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2-methyltetrazol-5-yl)carbamothioyl]-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17334740 |
| Molecular Formula | C16H18N8O4S |
| Molecular Weight | 418.44 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (E)-N-[(2-methyltetrazol-5-yl)carbamothioyl]-3-(4-morpholin-4-yl-3-nitrophenyl)prop-2-enamide |
| SMILES | Cn1nnc(NC(=S)NC(=O)/C=C/c2ccc(N3CCOCC3)c([N+](=O)[O-])c2)n1 |
| InChI | InChI=1S/C16H18N8O4S/c1-22-20-15(19-21-22)18-16(29)17-14(25)5-3-11-2-4-12(13(10-11)24(26)27)23-6-8-28-9-7-23/h2-5,10H,6-9H2,1H3,(H2,17,18,20,25,29)/b5-3+ |
| InChIKey | JDIYCDZADXGUGS-HWKANZROSA-N |
| XLogP | 0.48 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.44 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|