C12H12N6OS — CID 953461
N-[(2-methyltetrazol-5-yl)carbamothioyl]-3-phenylprop-2-enamide (PubChem CID 953461) has the molecular formula C12H12N6OS and a molecular weight of 288.34 g/mol. Its IUPAC name is N-[(2-methyltetrazol-5-yl)carbamothioyl]-3-phenylprop-2-enamide.
| Compound Name | N-[(2-methyltetrazol-5-yl)carbamothioyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 953461 |
| Molecular Formula | C12H12N6OS |
| Molecular Weight | 288.34 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | N-[(2-methyltetrazol-5-yl)carbamothioyl]-3-phenylprop-2-enamide |
| SMILES | Cn1nnc(NC(=S)NC(=O)C=Cc2ccccc2)n1 |
| InChI | InChI=1S/C12H12N6OS/c1-18-16-11(15-17-18)14-12(20)13-10(19)8-7-9-5-3-2-4-6-9/h2-8H,1H3,(H2,13,14,16,19,20) |
| InChIKey | IUONDHHIZMHRDI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.34 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|