C16H20N6O2S — CID 17334434
(E)-N-[(2-butyltetrazol-5-yl)carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide (PubChem CID 17334434) has the molecular formula C16H20N6O2S and a molecular weight of 360.44 g/mol. Its IUPAC name is (E)-N-[(2-butyltetrazol-5-yl)carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[(2-butyltetrazol-5-yl)carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17334434 |
| Molecular Formula | C16H20N6O2S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | (E)-N-[(2-butyltetrazol-5-yl)carbamothioyl]-3-(4-methoxyphenyl)prop-2-enamide |
| SMILES | CCCCn1nnc(NC(=S)NC(=O)/C=C/c2ccc(OC)cc2)n1 |
| InChI | InChI=1S/C16H20N6O2S/c1-3-4-11-22-20-15(19-21-22)18-16(25)17-14(23)10-7-12-5-8-13(24-2)9-6-12/h5-10H,3-4,11H2,1-2H3,(H2,17,18,20,23,25)/b10-7+ |
| InChIKey | HDFDRIQZXBDQAV-JXMROGBWSA-N |
| XLogP | 2.01 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|