C12H22N6OS — CID 3514841
N-[(2-butyltetrazol-5-yl)carbamothioyl]hexanamide (PubChem CID 3514841) has the molecular formula C12H22N6OS and a molecular weight of 298.42 g/mol. Its IUPAC name is N-[(2-butyltetrazol-5-yl)carbamothioyl]hexanamide.
| Compound Name | N-[(2-butyltetrazol-5-yl)carbamothioyl]hexanamide |
|---|---|
| PubChem CID | 3514841 |
| Molecular Formula | C12H22N6OS |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | N-[(2-butyltetrazol-5-yl)carbamothioyl]hexanamide |
| SMILES | CCCCCC(=O)NC(=S)Nc1nnn(CCCC)n1 |
| InChI | InChI=1S/C12H22N6OS/c1-3-5-7-8-10(19)13-12(20)14-11-15-17-18(16-11)9-6-4-2/h3-9H2,1-2H3,(H2,13,14,16,19,20) |
| InChIKey | WTUGRSLUSKQVRM-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|