C13H16N6OS — CID 959838
4-methyl-N-[(2-propyltetrazol-5-yl)carbamothioyl]benzamide (PubChem CID 959838) has the molecular formula C13H16N6OS and a molecular weight of 304.38 g/mol. Its IUPAC name is 4-methyl-N-[(2-propyltetrazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 4-methyl-N-[(2-propyltetrazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 959838 |
| Molecular Formula | C13H16N6OS |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-methyl-N-[(2-propyltetrazol-5-yl)carbamothioyl]benzamide |
| SMILES | CCCn1nnc(NC(=S)NC(=O)c2ccc(C)cc2)n1 |
| InChI | InChI=1S/C13H16N6OS/c1-3-8-19-17-12(16-18-19)15-13(21)14-11(20)10-6-4-9(2)5-7-10/h4-7H,3,8H2,1-2H3,(H2,14,15,17,20,21) |
| InChIKey | IQOCKYGDZRKMCC-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|