C18H26N6O4S — CID 5109132
3,4,5-triethoxy-N-[(2-propyltetrazol-5-yl)carbamothioyl]benzamide (PubChem CID 5109132) has the molecular formula C18H26N6O4S and a molecular weight of 422.51 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[(2-propyltetrazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[(2-propyltetrazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5109132 |
| Molecular Formula | C18H26N6O4S |
| Molecular Weight | 422.51 g/mol |
| Exact Mass | 422.17 |
| IUPAC Name | 3,4,5-triethoxy-N-[(2-propyltetrazol-5-yl)carbamothioyl]benzamide |
| SMILES | CCCn1nnc(NC(=S)NC(=O)c2cc(OCC)c(OCC)c(OCC)c2)n1 |
| InChI | InChI=1S/C18H26N6O4S/c1-5-9-24-22-17(21-23-24)20-18(29)19-16(25)12-10-13(26-6-2)15(28-8-4)14(11-12)27-7-3/h10-11H,5-9H2,1-4H3,(H2,19,20,22,25,29) |
| InChIKey | QOZDZVOJUNXNHJ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 112.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|