C16H22N6OS — CID 4310789
N-[(2-butyltetrazol-5-yl)carbamothioyl]-4-propan-2-ylbenzamide (PubChem CID 4310789) has the molecular formula C16H22N6OS and a molecular weight of 346.46 g/mol. Its IUPAC name is N-[(2-butyltetrazol-5-yl)carbamothioyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[(2-butyltetrazol-5-yl)carbamothioyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 4310789 |
| Molecular Formula | C16H22N6OS |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | N-[(2-butyltetrazol-5-yl)carbamothioyl]-4-propan-2-ylbenzamide |
| SMILES | CCCCn1nnc(NC(=S)NC(=O)c2ccc(C(C)C)cc2)n1 |
| InChI | InChI=1S/C16H22N6OS/c1-4-5-10-22-20-15(19-21-22)18-16(24)17-14(23)13-8-6-12(7-9-13)11(2)3/h6-9,11H,4-5,10H2,1-3H3,(H2,17,18,20,23,24) |
| InChIKey | ZOJCHGNYKAPMTO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 84.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|