C14H18N6O2S — CID 4203974
N-[(2-butyltetrazol-5-yl)carbamothioyl]-2-methoxybenzamide (PubChem CID 4203974) has the molecular formula C14H18N6O2S and a molecular weight of 334.41 g/mol. Its IUPAC name is N-[(2-butyltetrazol-5-yl)carbamothioyl]-2-methoxybenzamide.
| Compound Name | N-[(2-butyltetrazol-5-yl)carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4203974 |
| Molecular Formula | C14H18N6O2S |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-[(2-butyltetrazol-5-yl)carbamothioyl]-2-methoxybenzamide |
| SMILES | CCCCn1nnc(NC(=S)NC(=O)c2ccccc2OC)n1 |
| InChI | InChI=1S/C14H18N6O2S/c1-3-4-9-20-18-13(17-19-20)16-14(23)15-12(21)10-7-5-6-8-11(10)22-2/h5-8H,3-4,9H2,1-2H3,(H2,15,16,18,21,23) |
| InChIKey | RKDWSEUUMUBUJW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 93.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|