C13H16BrN5O2 — CID 3996264
5-bromo-N-(2-butyltetrazol-5-yl)-2-methoxybenzamide (PubChem CID 3996264) has the molecular formula C13H16BrN5O2 and a molecular weight of 354.21 g/mol. Its IUPAC name is 5-bromo-N-(2-butyltetrazol-5-yl)-2-methoxybenzamide.
| Compound Name | 5-bromo-N-(2-butyltetrazol-5-yl)-2-methoxybenzamide |
|---|---|
| PubChem CID | 3996264 |
| Molecular Formula | C13H16BrN5O2 |
| Molecular Weight | 354.21 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | 5-bromo-N-(2-butyltetrazol-5-yl)-2-methoxybenzamide |
| SMILES | CCCCn1nnc(NC(=O)c2cc(Br)ccc2OC)n1 |
| InChI | InChI=1S/C13H16BrN5O2/c1-3-4-7-19-17-13(16-18-19)15-12(20)10-8-9(14)5-6-11(10)21-2/h5-6,8H,3-4,7H2,1-2H3,(H,15,17,20) |
| InChIKey | JKEJRUVUZQWODL-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.21 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |