C12H11Br2N5O2 — CID 17177288
3,5-dibromo-2-methoxy-N-(2-prop-2-enyltetrazol-5-yl)benzamide (PubChem CID 17177288) has the molecular formula C12H11Br2N5O2 and a molecular weight of 417.06 g/mol. Its IUPAC name is 3,5-dibromo-2-methoxy-N-(2-prop-2-enyltetrazol-5-yl)benzamide.
| Compound Name | 3,5-dibromo-2-methoxy-N-(2-prop-2-enyltetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 17177288 |
| Molecular Formula | C12H11Br2N5O2 |
| Molecular Weight | 417.06 g/mol |
| Exact Mass | 414.93 |
| IUPAC Name | 3,5-dibromo-2-methoxy-N-(2-prop-2-enyltetrazol-5-yl)benzamide |
| SMILES | C=CCn1nnc(NC(=O)c2cc(Br)cc(Br)c2OC)n1 |
| InChI | InChI=1S/C12H11Br2N5O2/c1-3-4-19-17-12(16-18-19)15-11(20)8-5-7(13)6-9(14)10(8)21-2/h3,5-6H,1,4H2,2H3,(H,15,17,20) |
| InChIKey | SPUFYMDBYAPDMY-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.06 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|