C14H17N5O4 — CID 17177286
3,4,5-trimethoxy-N-(2-prop-2-enyltetrazol-5-yl)benzamide (PubChem CID 17177286) has the molecular formula C14H17N5O4 and a molecular weight of 319.32 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-(2-prop-2-enyltetrazol-5-yl)benzamide.
| Compound Name | 3,4,5-trimethoxy-N-(2-prop-2-enyltetrazol-5-yl)benzamide |
|---|---|
| PubChem CID | 17177286 |
| Molecular Formula | C14H17N5O4 |
| Molecular Weight | 319.32 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | 3,4,5-trimethoxy-N-(2-prop-2-enyltetrazol-5-yl)benzamide |
| SMILES | C=CCn1nnc(NC(=O)c2cc(OC)c(OC)c(OC)c2)n1 |
| InChI | InChI=1S/C14H17N5O4/c1-5-6-19-17-14(16-18-19)15-13(20)9-7-10(21-2)12(23-4)11(8-9)22-3/h5,7-8H,1,6H2,2-4H3,(H,15,17,20) |
| InChIKey | HHNRSOTYHZRMOO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 100.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.32 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|