C17H23N3O4 — CID 4246879
N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3,4,5-trimethoxybenzamide (PubChem CID 4246879) has the molecular formula C17H23N3O4 and a molecular weight of 333.39 g/mol. Its IUPAC name is N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3,4,5-trimethoxybenzamide.
| Compound Name | N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 4246879 |
| Molecular Formula | C17H23N3O4 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.17 |
| IUPAC Name | N-(1-ethyl-3,5-dimethylpyrazol-4-yl)-3,4,5-trimethoxybenzamide |
| SMILES | CCn1nc(C)c(NC(=O)c2cc(OC)c(OC)c(OC)c2)c1C |
| InChI | InChI=1S/C17H23N3O4/c1-7-20-11(3)15(10(2)19-20)18-17(21)12-8-13(22-4)16(24-6)14(9-12)23-5/h8-9H,7H2,1-6H3,(H,18,21) |
| InChIKey | SSYALJHOUOIFEJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |