C21H23N3O3 — CID 19335776
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3,5-dimethoxybenzamide (PubChem CID 19335776) has the molecular formula C21H23N3O3 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3,5-dimethoxybenzamide.
| Compound Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 19335776 |
| Molecular Formula | C21H23N3O3 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.17 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2c(C)nn(Cc3ccccc3)c2C)c1 |
| InChI | InChI=1S/C21H23N3O3/c1-14-20(15(2)24(23-14)13-16-8-6-5-7-9-16)22-21(25)17-10-18(26-3)12-19(11-17)27-4/h5-12H,13H2,1-4H3,(H,22,25) |
| InChIKey | LJDZYTUXDSCLJQ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |