C20H19F2N3O2 — CID 19335756
N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-(difluoromethoxy)benzamide (PubChem CID 19335756) has the molecular formula C20H19F2N3O2 and a molecular weight of 371.39 g/mol. Its IUPAC name is N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-(difluoromethoxy)benzamide.
| Compound Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 19335756 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | N-(1-benzyl-3,5-dimethylpyrazol-4-yl)-4-(difluoromethoxy)benzamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1NC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C20H19F2N3O2/c1-13-18(14(2)25(24-13)12-15-6-4-3-5-7-15)23-19(26)16-8-10-17(11-9-16)27-20(21)22/h3-11,20H,12H2,1-2H3,(H,23,26) |
| InChIKey | RLUFJXGYEKGTES-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |