C21H21F2N3O2 — CID 27331273
N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(difluoromethoxy)benzamide (PubChem CID 27331273) has the molecular formula C21H21F2N3O2 and a molecular weight of 385.41 g/mol. Its IUPAC name is N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(difluoromethoxy)benzamide.
| Compound Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(difluoromethoxy)benzamide |
|---|---|
| PubChem CID | 27331273 |
| Molecular Formula | C21H21F2N3O2 |
| Molecular Weight | 385.41 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(difluoromethoxy)benzamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C21H21F2N3O2/c1-14-19(15(2)26(25-14)13-16-6-4-3-5-7-16)12-24-20(27)17-8-10-18(11-9-17)28-21(22)23/h3-11,21H,12-13H2,1-2H3,(H,24,27) |
| InChIKey | BZMWFSJDIOTZJY-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.41 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |