C24H29N3O — CID 8943315
N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-tert-butylbenzamide (PubChem CID 8943315) has the molecular formula C24H29N3O and a molecular weight of 375.52 g/mol. Its IUPAC name is N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-tert-butylbenzamide.
| Compound Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-tert-butylbenzamide |
|---|---|
| PubChem CID | 8943315 |
| Molecular Formula | C24H29N3O |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-tert-butylbenzamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H29N3O/c1-17-22(18(2)27(26-17)16-19-9-7-6-8-10-19)15-25-23(28)20-11-13-21(14-12-20)24(3,4)5/h6-14H,15-16H2,1-5H3,(H,25,28) |
| InChIKey | GVKPUSJUZXIUDM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |