C26H26N4O3S — CID 27331227
N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(phenylsulfamoyl)benzamide (PubChem CID 27331227) has the molecular formula C26H26N4O3S and a molecular weight of 474.59 g/mol. Its IUPAC name is N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(phenylsulfamoyl)benzamide.
| Compound Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(phenylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 27331227 |
| Molecular Formula | C26H26N4O3S |
| Molecular Weight | 474.59 g/mol |
| Exact Mass | 474.17 |
| IUPAC Name | N-[(1-benzyl-3,5-dimethylpyrazol-4-yl)methyl]-4-(phenylsulfamoyl)benzamide |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1CNC(=O)c1ccc(S(=O)(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C26H26N4O3S/c1-19-25(20(2)30(28-19)18-21-9-5-3-6-10-21)17-27-26(31)22-13-15-24(16-14-22)34(32,33)29-23-11-7-4-8-12-23/h3-16,29H,17-18H2,1-2H3,(H,27,31) |
| InChIKey | BBXIZEFQYZTIHN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.59 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |