C21H18F5N3O3 — CID 19402023
N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3,5-dimethoxybenzamide (PubChem CID 19402023) has the molecular formula C21H18F5N3O3 and a molecular weight of 455.38 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3,5-dimethoxybenzamide.
| Compound Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 19402023 |
| Molecular Formula | C21H18F5N3O3 |
| Molecular Weight | 455.38 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3,5-dimethoxybenzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2c(C)nn(Cc3c(F)c(F)c(F)c(F)c3F)c2C)c1 |
| InChI | InChI=1S/C21H18F5N3O3/c1-9-20(27-21(30)11-5-12(31-3)7-13(6-11)32-4)10(2)29(28-9)8-14-15(22)17(24)19(26)18(25)16(14)23/h5-7H,8H2,1-4H3,(H,27,30) |
| InChIKey | OSBDDKUUYVOMEF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.38 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|