C26H18Cl2F5N3O2 — CID 5075159
4-[(2,5-dichlorophenoxy)methyl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]benzamide (PubChem CID 5075159) has the molecular formula C26H18Cl2F5N3O2 and a molecular weight of 570.35 g/mol. Its IUPAC name is 4-[(2,5-dichlorophenoxy)methyl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]benzamide.
| Compound Name | 4-[(2,5-dichlorophenoxy)methyl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]benzamide |
|---|---|
| PubChem CID | 5075159 |
| Molecular Formula | C26H18Cl2F5N3O2 |
| Molecular Weight | 570.35 g/mol |
| Exact Mass | 569.07 |
| IUPAC Name | 4-[(2,5-dichlorophenoxy)methyl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]benzamide |
| SMILES | Cc1nn(Cc2c(F)c(F)c(F)c(F)c2F)c(C)c1NC(=O)c1ccc(COc2cc(Cl)ccc2Cl)cc1 |
| InChI | InChI=1S/C26H18Cl2F5N3O2/c1-12-25(13(2)36(35-12)10-17-20(29)22(31)24(33)23(32)21(17)30)34-26(37)15-5-3-14(4-6-15)11-38-19-9-16(27)7-8-18(19)28/h3-9H,10-11H2,1-2H3,(H,34,37) |
| InChIKey | RKPCKKVZIFKDTO-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.35 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|