C17H13BrF5N5O — CID 4252326
4-bromo-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-1-methylpyrazole-3-carboxamide (PubChem CID 4252326) has the molecular formula C17H13BrF5N5O and a molecular weight of 478.22 g/mol. Its IUPAC name is 4-bromo-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-1-methylpyrazole-3-carboxamide.
| Compound Name | 4-bromo-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-1-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4252326 |
| Molecular Formula | C17H13BrF5N5O |
| Molecular Weight | 478.22 g/mol |
| Exact Mass | 477.02 |
| IUPAC Name | 4-bromo-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-1-methylpyrazole-3-carboxamide |
| SMILES | Cc1nn(Cc2c(F)c(F)c(F)c(F)c2F)c(C)c1NC(=O)c1nn(C)cc1Br |
| InChI | InChI=1S/C17H13BrF5N5O/c1-6-15(24-17(29)16-9(18)5-27(3)26-16)7(2)28(25-6)4-8-10(19)12(21)14(23)13(22)11(8)20/h5H,4H2,1-3H3,(H,24,29) |
| InChIKey | GPQABHHTEVDJMY-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.22 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|