C17H13ClF5N5O — CID 19402137
2-(4-chloropyrazol-1-yl)-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide (PubChem CID 19402137) has the molecular formula C17H13ClF5N5O and a molecular weight of 433.77 g/mol. Its IUPAC name is 2-(4-chloropyrazol-1-yl)-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide.
| Compound Name | 2-(4-chloropyrazol-1-yl)-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 19402137 |
| Molecular Formula | C17H13ClF5N5O |
| Molecular Weight | 433.77 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | 2-(4-chloropyrazol-1-yl)-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide |
| SMILES | Cc1nn(Cc2c(F)c(F)c(F)c(F)c2F)c(C)c1NC(=O)Cn1cc(Cl)cn1 |
| InChI | InChI=1S/C17H13ClF5N5O/c1-7-17(25-11(29)6-27-4-9(18)3-24-27)8(2)28(26-7)5-10-12(19)14(21)16(23)15(22)13(10)20/h3-4H,5-6H2,1-2H3,(H,25,29) |
| InChIKey | BJFMEXKIYMKTLA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.77 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|