C21H18F7N5O — CID 19402048
2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide (PubChem CID 19402048) has the molecular formula C21H18F7N5O and a molecular weight of 489.40 g/mol. Its IUPAC name is 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide.
| Compound Name | 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide |
|---|---|
| PubChem CID | 19402048 |
| Molecular Formula | C21H18F7N5O |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.14 |
| IUPAC Name | 2-[5-cyclopropyl-3-(difluoromethyl)pyrazol-1-yl]-N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]acetamide |
| SMILES | Cc1nn(Cc2c(F)c(F)c(F)c(F)c2F)c(C)c1NC(=O)Cn1nc(C(F)F)cc1C1CC1 |
| InChI | InChI=1S/C21H18F7N5O/c1-8-20(29-14(34)7-33-13(10-3-4-10)5-12(31-33)21(27)28)9(2)32(30-8)6-11-15(22)17(24)19(26)18(25)16(11)23/h5,10,21H,3-4,6-7H2,1-2H3,(H,29,34) |
| InChIKey | VEXKTZSKLHRDGZ-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 64.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|