C18H15F5N4OS3 — CID 19401979
N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxamide (PubChem CID 19401979) has the molecular formula C18H15F5N4OS3 and a molecular weight of 494.54 g/mol. Its IUPAC name is N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxamide.
| Compound Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 19401979 |
| Molecular Formula | C18H15F5N4OS3 |
| Molecular Weight | 494.54 g/mol |
| Exact Mass | 494.03 |
| IUPAC Name | N-[3,5-dimethyl-1-[(2,3,4,5,6-pentafluorophenyl)methyl]pyrazol-4-yl]-3,5-bis(methylsulfanyl)-1,2-thiazole-4-carboxamide |
| SMILES | CSc1nsc(SC)c1C(=O)Nc1c(C)nn(Cc2c(F)c(F)c(F)c(F)c2F)c1C |
| InChI | InChI=1S/C18H15F5N4OS3/c1-6-15(24-16(28)9-17(29-3)26-31-18(9)30-4)7(2)27(25-6)5-8-10(19)12(21)14(23)13(22)11(8)20/h5H2,1-4H3,(H,24,28) |
| InChIKey | UFIBLWGAKFZIFA-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.54 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|