C27H35N5O4 — CID 46293260
N-[N-(2,3-dimethylphenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide (PubChem CID 46293260) has the molecular formula C27H35N5O4 and a molecular weight of 493.61 g/mol. Its IUPAC name is N-[N-(2,3-dimethylphenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[N-(2,3-dimethylphenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 46293260 |
| Molecular Formula | C27H35N5O4 |
| Molecular Weight | 493.61 g/mol |
| Exact Mass | 493.27 |
| IUPAC Name | N-[N-(2,3-dimethylphenyl)-N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]carbamimidoyl]-3,4,5-trimethoxybenzamide |
| SMILES | CCn1nc(C)c(C/N=C(\NC(=O)c2cc(OC)c(OC)c(OC)c2)Nc2cccc(C)c2C)c1C |
| InChI | InChI=1S/C27H35N5O4/c1-9-32-19(5)21(18(4)31-32)15-28-27(29-22-12-10-11-16(2)17(22)3)30-26(33)20-13-23(34-6)25(36-8)24(14-20)35-7/h10-14H,9,15H2,1-8H3,(H2,28,29,30,33) |
| InChIKey | OKGGRWNNSJAYFQ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.61 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|