C23H26BrN5O — CID 46293163
2-bromo-N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methylphenyl)carbamimidoyl]benzamide (PubChem CID 46293163) has the molecular formula C23H26BrN5O and a molecular weight of 468.40 g/mol. Its IUPAC name is 2-bromo-N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methylphenyl)carbamimidoyl]benzamide.
| Compound Name | 2-bromo-N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methylphenyl)carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46293163 |
| Molecular Formula | C23H26BrN5O |
| Molecular Weight | 468.40 g/mol |
| Exact Mass | 467.13 |
| IUPAC Name | 2-bromo-N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methylphenyl)carbamimidoyl]benzamide |
| SMILES | CCn1nc(C)c(C/N=C(\NC(=O)c2ccccc2Br)Nc2ccccc2C)c1C |
| InChI | InChI=1S/C23H26BrN5O/c1-5-29-17(4)19(16(3)28-29)14-25-23(26-21-13-9-6-10-15(21)2)27-22(30)18-11-7-8-12-20(18)24/h6-13H,5,14H2,1-4H3,(H2,25,26,27,30) |
| InChIKey | AXQFMLMTXSCISW-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 71.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.40 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|