C24H26F3N5O2 — CID 46292916
N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyphenyl)carbamimidoyl]-4-(trifluoromethyl)benzamide (PubChem CID 46292916) has the molecular formula C24H26F3N5O2 and a molecular weight of 473.50 g/mol. Its IUPAC name is N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyphenyl)carbamimidoyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyphenyl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 46292916 |
| Molecular Formula | C24H26F3N5O2 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.20 |
| IUPAC Name | N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxyphenyl)carbamimidoyl]-4-(trifluoromethyl)benzamide |
| SMILES | CCn1nc(C)c(C/N=C(\NC(=O)c2ccc(C(F)(F)F)cc2)Nc2ccccc2OC)c1C |
| InChI | InChI=1S/C24H26F3N5O2/c1-5-32-16(3)19(15(2)31-32)14-28-23(29-20-8-6-7-9-21(20)34-4)30-22(33)17-10-12-18(13-11-17)24(25,26)27/h6-13H,5,14H2,1-4H3,(H2,28,29,30,33) |
| InChIKey | SDWDNWHXDJYZQY-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 80.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|