C26H33N5O4 — CID 46293103
N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxy-5-methylphenyl)carbamimidoyl]-2,3-dimethoxybenzamide (PubChem CID 46293103) has the molecular formula C26H33N5O4 and a molecular weight of 479.58 g/mol. Its IUPAC name is N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxy-5-methylphenyl)carbamimidoyl]-2,3-dimethoxybenzamide.
| Compound Name | N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxy-5-methylphenyl)carbamimidoyl]-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 46293103 |
| Molecular Formula | C26H33N5O4 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.25 |
| IUPAC Name | N-[N'-[(1-ethyl-3,5-dimethylpyrazol-4-yl)methyl]-N-(2-methoxy-5-methylphenyl)carbamimidoyl]-2,3-dimethoxybenzamide |
| SMILES | CCn1nc(C)c(C/N=C(\NC(=O)c2cccc(OC)c2OC)Nc2cc(C)ccc2OC)c1C |
| InChI | InChI=1S/C26H33N5O4/c1-8-31-18(4)20(17(3)30-31)15-27-26(28-21-14-16(2)12-13-22(21)33-5)29-25(32)19-10-9-11-23(34-6)24(19)35-7/h9-14H,8,15H2,1-7H3,(H2,27,28,29,32) |
| InChIKey | JBJDTOJTBBWIMC-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|