C24H29N5O4 — CID 46293395
3,4-dimethoxy-N-[N-(2-methoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide (PubChem CID 46293395) has the molecular formula C24H29N5O4 and a molecular weight of 451.53 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[N-(2-methoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[N-(2-methoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46293395 |
| Molecular Formula | C24H29N5O4 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | 3,4-dimethoxy-N-[N-(2-methoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
| SMILES | COc1ccccc1N/C(=N/Cc1c(C)nn(C)c1C)NC(=O)c1ccc(OC)c(OC)c1 |
| InChI | InChI=1S/C24H29N5O4/c1-15-18(16(2)29(3)28-15)14-25-24(26-19-9-7-8-10-20(19)31-4)27-23(30)17-11-12-21(32-5)22(13-17)33-6/h7-13H,14H2,1-6H3,(H2,25,26,27,30) |
| InChIKey | LKVOEADAWRNANO-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|