C27H35N5O3 — CID 46293353
4-tert-butyl-N-[N-(3,4-dimethoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide (PubChem CID 46293353) has the molecular formula C27H35N5O3 and a molecular weight of 477.61 g/mol. Its IUPAC name is 4-tert-butyl-N-[N-(3,4-dimethoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide.
| Compound Name | 4-tert-butyl-N-[N-(3,4-dimethoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
|---|---|
| PubChem CID | 46293353 |
| Molecular Formula | C27H35N5O3 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.27 |
| IUPAC Name | 4-tert-butyl-N-[N-(3,4-dimethoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]benzamide |
| SMILES | COc1ccc(N/C(=N/Cc2c(C)nn(C)c2C)NC(=O)c2ccc(C(C)(C)C)cc2)cc1OC |
| InChI | InChI=1S/C27H35N5O3/c1-17-22(18(2)32(6)31-17)16-28-26(29-21-13-14-23(34-7)24(15-21)35-8)30-25(33)19-9-11-20(12-10-19)27(3,4)5/h9-15H,16H2,1-8H3,(H2,28,29,30,33) |
| InChIKey | OTBAJOCVACPIKQ-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|