C23H26FN5O3 — CID 46293613
N-[N-(3,4-dimethoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-fluorobenzamide (PubChem CID 46293613) has the molecular formula C23H26FN5O3 and a molecular weight of 439.49 g/mol. Its IUPAC name is N-[N-(3,4-dimethoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-fluorobenzamide.
| Compound Name | N-[N-(3,4-dimethoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 46293613 |
| Molecular Formula | C23H26FN5O3 |
| Molecular Weight | 439.49 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | N-[N-(3,4-dimethoxyphenyl)-N'-[(1,3,5-trimethylpyrazol-4-yl)methyl]carbamimidoyl]-3-fluorobenzamide |
| SMILES | COc1ccc(N/C(=N/Cc2c(C)nn(C)c2C)NC(=O)c2cccc(F)c2)cc1OC |
| InChI | InChI=1S/C23H26FN5O3/c1-14-19(15(2)29(3)28-14)13-25-23(27-22(30)16-7-6-8-17(24)11-16)26-18-9-10-20(31-4)21(12-18)32-5/h6-12H,13H2,1-5H3,(H2,25,26,27,30) |
| InChIKey | XJYYIXXWFJBQIP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.49 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|